CAS 1047648-43-0 is the registry number for 1-(Chlorodifluoromethoxy)-2-nitrobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[chloro(difluoro)methoxy]-2-nitrobenzene (CAS 1047648-43-0) is a chemical compound with the molecular formula C7H4ClF2NO3 and a molecular weight of 223.56 g/mol. IUPAC name: 1-[chloro(difluoro)methoxy]-2-nitrobenzene. InChIKey: NOXFKTUASDPYMW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO3 |
|---|---|
| Molecular weight | 223.56 g/mol |
| IUPAC name | 1-[chloro(difluoro)methoxy]-2-nitrobenzene |
| InChIKey | NOXFKTUASDPYMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC(F)(F)Cl |
Computed by PubChem (NCBI)