CAS 1805519-37-2 appears in our catalog under these names: 2-Chloro-6-(difluoromethoxy)nicotinic acid, 97%, 2-Chloro-6-(difluoromethoxy)nicotinic acid, 98%, 2-Chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid, 2-Chloro-6-(Difluoromethoxy)Nicotinic Acid, 98%, 98%. Offered by: AmBeed, Fluorochem, Biosynth, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 0,5g, 50mg.
2-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid (CAS 1805519-37-2) is a chemical compound with the molecular formula C7H4ClF2NO3 and a molecular weight of 223.56 g/mol. IUPAC name: 2-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid. InChIKey: ILYAHRKPNMMRLW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO3 |
|---|---|
| Molecular weight | 223.56 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | ILYAHRKPNMMRLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)OC(F)F |
Computed by PubChem (NCBI)