Products 104773-40-2
CAS 104773-40-2 is the registry number for (2S，4S)-4-(Acetylthio)-2-(hydroxymethyl)-1-pyrrolidinecarboxylic acid (4-nitrophenyl)methyl ester, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-nitrophenyl)methyl 4-acetylsulfanyl-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 104773-40-2) is a chemical compound with the molecular formula C15H18N2O6S and a molecular weight of 354.4 g/mol. IUPAC name: (4-nitrophenyl)methyl 4-acetylsulfanyl-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: ISMJAKHUEXVPIA-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O6S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | ISMJAKHUEXVPIA-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1CC(N(C1)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)