CAS 1216182-44-3 is the registry number for 1-((2-Methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)sulfonyl)piperidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylic acid (CAS 1216182-44-3) is a chemical compound with the molecular formula C15H18N2O6S and a molecular weight of 354.4 g/mol. IUPAC name: 1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylic acid. InChIKey: KGEXXCRLFSLOSR-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O6S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylic acid |
| InChIKey | KGEXXCRLFSLOSR-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)S(=O)(=O)N3CCCC(C3)C(=O)O |
Computed by PubChem (NCBI)