Products 1048034-95-2
CAS 1048034-95-2 appears in our catalog under these names: 3-Cyano-4-(trifluoromethyl)benzoic acid, 3-Cyano-4-(trifluoromethyl)benzoic acid, 98%, 98%, 3-Cyano-4-(trifluoromethyl)benzoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
3-cyano-4-(trifluoromethyl)benzoic acid (CAS 1048034-95-2) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 3-cyano-4-(trifluoromethyl)benzoic acid. InChIKey: BGQDDAISOZKNMR-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 3-cyano-4-(trifluoromethyl)benzoic acid |
| InChIKey | BGQDDAISOZKNMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C#N)C(F)(F)F |
Computed by PubChem (NCBI)