CAS 104810-48-2 appears in our catalog under these names: Tinuvin-1130, α-[3-[3-(2H-Benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropyl]-ω-hydroxypoly(oxy-1,2-ethanediyl), 98%,RG, 98%,RG. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg, 2.5kg, 5g, 25g.
Methyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate (CAS 104810-48-2) is a chemical compound with the molecular formula C20H23N3O3 and a molecular weight of 353.4 g/mol. IUPAC name: methyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate. InChIKey: UJRDRFZCRQNLJM-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O3 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | methyl 3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate |
| InChIKey | UJRDRFZCRQNLJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)CCC(=O)OC)N2N=C3C=CC=CC3=N2)O |
Computed by PubChem (NCBI)