Products 1142206-02-7

CAS 1142206-02-7 is the registry number for ((2-Oxo-2-(4-phenylpiperazin-1-yl)ethyl)(phenyl)amino)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]anilino)acetic acid (CAS 1142206-02-7) is a chemical compound with the molecular formula C20H23N3O3 and a molecular weight of 353.4 g/mol. IUPAC name: 2-(N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]anilino)acetic acid. InChIKey: GDJWWLQOZMZELX-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23N3O3
Molecular weight353.4 g/mol
IUPAC name2-(N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]anilino)acetic acid
InChIKeyGDJWWLQOZMZELX-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC=CC=C2)C(=O)CN(CC(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)