Products 104860-37-9
CAS 104860-37-9 is the registry number for (3R,4R)-1-BENZYL-4-(BENZYLAMINO)PIPERIDIN-3-OL, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R,4R)-1-benzyl-4-(benzylamino)piperidin-3-ol (CAS 104860-37-9) is a chemical compound with the molecular formula C19H24N2O and a molecular weight of 296.4 g/mol. IUPAC name: (3R,4R)-1-benzyl-4-(benzylamino)piperidin-3-ol. InChIKey: HUVGDTRCZVNHGX-RTBURBONSA-N.
| Molecular formula | C19H24N2O |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-4-(benzylamino)piperidin-3-ol |
| InChIKey | HUVGDTRCZVNHGX-RTBURBONSA-N |
| SMILES | C1CN(C[C@H]([C@@H]1NCC2=CC=CC=C2)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)