Products 216481-22-0
CAS 216481-22-0 is the registry number for (3S,4S)-1-Benzyl-4-(benzylamino)piperidin-3-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(3S,4S)-1-benzyl-4-(benzylamino)piperidin-3-ol (CAS 216481-22-0) is a chemical compound with the molecular formula C19H24N2O and a molecular weight of 296.4 g/mol. IUPAC name: (3S,4S)-1-benzyl-4-(benzylamino)piperidin-3-ol. InChIKey: HUVGDTRCZVNHGX-OALUTQOASA-N.
| Molecular formula | C19H24N2O |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (3S,4S)-1-benzyl-4-(benzylamino)piperidin-3-ol |
| InChIKey | HUVGDTRCZVNHGX-OALUTQOASA-N |
| SMILES | C1CN(C[C@@H]([C@H]1NCC2=CC=CC=C2)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)