CAS 1048640-47-6 is the registry number for N-Benzyl-1-(4-biphenylyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-phenyl-N-[(4-phenylphenyl)methyl]methanamine;hydrochloride (CAS 1048640-47-6) is a chemical compound with the molecular formula C20H20ClN and a molecular weight of 309.8 g/mol. IUPAC name: 1-phenyl-N-[(4-phenylphenyl)methyl]methanamine;hydrochloride. InChIKey: YFVCXGLPZUHXOL-UHFFFAOYSA-N.
| Molecular formula | C20H20ClN |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 1-phenyl-N-[(4-phenylphenyl)methyl]methanamine;hydrochloride |
| InChIKey | YFVCXGLPZUHXOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)