CAS 98978-52-0 appears in our catalog under these names: Desmethyl Naftifine HCl, Naftifine Impurity 2 (Desmethyl Naftifine HCl), DESMETHYL NAFTIFINE HYDROCHLORIDE. Offered by: Chemat Brand, Hubei YoungXin, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride (CAS 98978-52-0) is a chemical compound with the molecular formula C20H20ClN and a molecular weight of 309.8 g/mol. IUPAC name: (E)-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride. InChIKey: UVSCTBDVRQOYAN-HCUGZAAXSA-N.
| Molecular formula | C20H20ClN |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | (E)-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride |
| InChIKey | UVSCTBDVRQOYAN-HCUGZAAXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CNCC2=CC=CC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)