CAS 1048703-18-9 is the registry number for (R)-3-(4-Fluorophenyl)pyrrolidine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
(3R)-3-(4-fluorophenyl)pyrrolidine (CAS 1048703-18-9) is a chemical compound with the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. IUPAC name: (3R)-3-(4-fluorophenyl)pyrrolidine. InChIKey: IWOQWISAVOSATC-VIFPVBQESA-N.
| Molecular formula | C10H12FN |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | (3R)-3-(4-fluorophenyl)pyrrolidine |
| InChIKey | IWOQWISAVOSATC-VIFPVBQESA-N |
| SMILES | C1CNC[C@H]1C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)