CAS 907973-43-7 appears in our catalog under these names: 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine, 95%, 5–Fluoro–1,2,3,4–tetrahydronaphthalen–1–amine, 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine 95%, 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine, 95%, 95%, 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg, 500mg.
5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 907973-43-7) is a chemical compound with the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. IUPAC name: 5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: YQYUGHNOJHWIJX-UHFFFAOYSA-N.
| Molecular formula | C10H12FN |
|---|---|
| Molecular weight | 165.21 g/mol |
| IUPAC name | 5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | YQYUGHNOJHWIJX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC=C2)F)N |
Computed by PubChem (NCBI)