CAS 1048915-92-9 is the registry number for 3-(2-(4-bromophenyl)-6-methyl-4-oxo-5,6,7-trihydroindolyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
3-[3-(4-bromophenyl)-6-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl]propanoic acid (CAS 1048915-92-9) is a chemical compound with the molecular formula C18H18BrNO3 and a molecular weight of 376.2 g/mol. IUPAC name: 3-[3-(4-bromophenyl)-6-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl]propanoic acid. InChIKey: MAVQTANPVVJKGF-UHFFFAOYSA-N.
| Molecular formula | C18H18BrNO3 |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | 3-[3-(4-bromophenyl)-6-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl]propanoic acid |
| InChIKey | MAVQTANPVVJKGF-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=O)C1)C(=CN2CCC(=O)O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)