Products 2504203-21-6

CAS 2504203-21-6 is the registry number for [1-(4-Bromo-phenoxymethyl)-cyclopropyl]-carbamic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-[(4-bromophenoxy)methyl]cyclopropyl]carbamate (CAS 2504203-21-6) is a chemical compound with the molecular formula C18H18BrNO3 and a molecular weight of 376.2 g/mol. IUPAC name: benzyl N-[1-[(4-bromophenoxy)methyl]cyclopropyl]carbamate. InChIKey: IZAVUPJECYUEEV-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18BrNO3
Molecular weight376.2 g/mol
IUPAC namebenzyl N-[1-[(4-bromophenoxy)methyl]cyclopropyl]carbamate
InChIKeyIZAVUPJECYUEEV-UHFFFAOYSA-N
SMILESC1CC1(COC2=CC=C(C=C2)Br)NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)