CAS 1048915-96-3 is the registry number for 4-((4-oxo-5-phenyl-2,3,5-triazolinyl)methoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-[(5-oxo-4-phenyl-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid (CAS 1048915-96-3) is a chemical compound with the molecular formula C16H13N3O4 and a molecular weight of 311.29 g/mol. IUPAC name: 4-[(5-oxo-4-phenyl-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid. InChIKey: GLDDYFLDOOCHHG-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O4 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 4-[(5-oxo-4-phenyl-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid |
| InChIKey | GLDDYFLDOOCHHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=O)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)