CAS 188544-09-4 is the registry number for 2-(3-(3-nitrophenyl)prop-2-enoylamino)benzamide. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g, 10g.
2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide (CAS 188544-09-4) is a chemical compound with the molecular formula C16H13N3O4 and a molecular weight of 311.29 g/mol. IUPAC name: 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide. InChIKey: CIPQJMMUCYHTME-CMDGGOBGSA-N.
| Molecular formula | C16H13N3O4 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide |
| InChIKey | CIPQJMMUCYHTME-CMDGGOBGSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NC(=O)/C=C/C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)