CAS 1048925-17-2 is the registry number for 1'-Sec-butyl-3',5'-dimethyl-1h,1'h-3,4'-bipyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(1-butan-2-yl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid (CAS 1048925-17-2) is a chemical compound with the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. IUPAC name: 3-(1-butan-2-yl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: WWSYXYDJJXNSCT-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O2 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 3-(1-butan-2-yl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | WWSYXYDJJXNSCT-UHFFFAOYSA-N |
| SMILES | CCC(C)N1C(=C(C(=N1)C)C2=NNC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)