CAS 438221-00-2 is the registry number for 3-(5-Methyl-2H-1,2,3,4-tetrazol-2-yl)adamantane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid (CAS 438221-00-2) is a chemical compound with the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. IUPAC name: 3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid. InChIKey: YUUZUFCTNHPCED-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O2 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid |
| InChIKey | YUUZUFCTNHPCED-UHFFFAOYSA-N |
| SMILES | CC1=NN(N=N1)C23CC4CC(C2)CC(C4)(C3)C(=O)O |
Computed by PubChem (NCBI)