Products 438221-00-2

CAS 438221-00-2 is the registry number for 3-(5-Methyl-2H-1,2,3,4-tetrazol-2-yl)adamantane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid (CAS 438221-00-2) is a chemical compound with the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. IUPAC name: 3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid. InChIKey: YUUZUFCTNHPCED-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N4O2
Molecular weight262.31 g/mol
IUPAC name3-(5-methyltetrazol-2-yl)adamantane-1-carboxylic acid
InChIKeyYUUZUFCTNHPCED-UHFFFAOYSA-N
SMILESCC1=NN(N=N1)C23CC4CC(C2)CC(C4)(C3)C(=O)O

Computed by PubChem (NCBI)