Products 1049037-64-0
CAS 1049037-64-0 appears in our catalog under these names: 1-Bromo-4-(bromomethyl)-2,3,5,6-tetrafluorobenzene, 95%, 1-Bromo-4-(bromomethyl)-2,3,5,6-tetrafluorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-bromo-4-(bromomethyl)-2,3,5,6-tetrafluorobenzene (CAS 1049037-64-0) is a chemical compound with the molecular formula C7H2Br2F4 and a molecular weight of 321.89 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-2,3,5,6-tetrafluorobenzene. InChIKey: WOPOBCPPAUSCFM-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2F4 |
|---|---|
| Molecular weight | 321.89 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-2,3,5,6-tetrafluorobenzene |
| InChIKey | WOPOBCPPAUSCFM-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)Br)F)F)Br |
Computed by PubChem (NCBI)