CAS 1804417-25-1 appears in our catalog under these names: 3,4-Dibromo-5-fluorobenzotrifluoride, 95%, 1,2-Dibromo-3-fluoro-5-(trifluoromethyl)benzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1,2-dibromo-3-fluoro-5-(trifluoromethyl)benzene (CAS 1804417-25-1) is a chemical compound with the molecular formula C7H2Br2F4 and a molecular weight of 321.89 g/mol. IUPAC name: 1,2-dibromo-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: JPFFTOWGWIUFQW-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2F4 |
|---|---|
| Molecular weight | 321.89 g/mol |
| IUPAC name | 1,2-dibromo-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | JPFFTOWGWIUFQW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)