CAS 104912-51-8 is the registry number for 6-Methyl-1-(4-nitrophenyl)-1H,4H,7H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-methyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 104912-51-8) is a chemical compound with the molecular formula C12H9N5O3 and a molecular weight of 271.23 g/mol. IUPAC name: 6-methyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: OZRINSNFKLYXQF-UHFFFAOYSA-N.
| Molecular formula | C12H9N5O3 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 6-methyl-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | OZRINSNFKLYXQF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3=CC=C(C=C3)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)