CAS 104933-75-7 appears in our catalog under these names: (Triphenylmethyl)hydrazine, 95%, Tritylhydrazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tritylhydrazine (CAS 104933-75-7) is a chemical compound with the molecular formula C19H18N2 and a molecular weight of 274.4 g/mol. IUPAC name: tritylhydrazine. InChIKey: XUECSRVFRKTFKJ-UHFFFAOYSA-N.
| Molecular formula | C19H18N2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | tritylhydrazine |
| InChIKey | XUECSRVFRKTFKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NN |
Computed by PubChem (NCBI)