Products 1529739-80-7

CAS 1529739-80-7 is the registry number for N1-Benzyl-N1-phenylbenzene-1,2-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-N-benzyl-2-N-phenylbenzene-1,2-diamine (CAS 1529739-80-7) is a chemical compound with the molecular formula C19H18N2 and a molecular weight of 274.4 g/mol. IUPAC name: 2-N-benzyl-2-N-phenylbenzene-1,2-diamine. InChIKey: VCMMQZFYLSZFNP-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2
Molecular weight274.4 g/mol
IUPAC name2-N-benzyl-2-N-phenylbenzene-1,2-diamine
InChIKeyVCMMQZFYLSZFNP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN(C2=CC=CC=C2)C3=CC=CC=C3N

Computed by PubChem (NCBI)