CAS 1049728-71-3 is the registry number for 4-Bromobenzene-1,3-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-bromobenzene-1,3-diamine;dihydrochloride (CAS 1049728-71-3) is a chemical compound with the molecular formula C6H9BrCl2N2 and a molecular weight of 259.96 g/mol. IUPAC name: 4-bromobenzene-1,3-diamine;dihydrochloride. InChIKey: ZPKHWILDPAREBE-UHFFFAOYSA-N.
| Molecular formula | C6H9BrCl2N2 |
|---|---|
| Molecular weight | 259.96 g/mol |
| IUPAC name | 4-bromobenzene-1,3-diamine;dihydrochloride |
| InChIKey | ZPKHWILDPAREBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)Br.Cl.Cl |
Computed by PubChem (NCBI)