CAS 1956309-87-7 appears in our catalog under these names: (6-Bromopyridin-2-yl)methanamine dihydrochloride, 95%, (6-Bromopyridin-2-yl)methanamine dihydrochloride, 97%, (6–Bromopyridin–2–yl)methanamine dihydrochloride, (6-Bromopyridin-2-yl)methanamine dihydrochloride, (6-Bromopyridin-2-yl)methanamine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.
(6-bromo-2-pyridinyl)methanamine;dihydrochloride (CAS 1956309-87-7) is a chemical compound with the molecular formula C6H9BrCl2N2 and a molecular weight of 259.96 g/mol. IUPAC name: (6-bromo-2-pyridinyl)methanamine;dihydrochloride. InChIKey: DFYWYWZREGWVBS-UHFFFAOYSA-N.
| Molecular formula | C6H9BrCl2N2 |
|---|---|
| Molecular weight | 259.96 g/mol |
| IUPAC name | (6-bromo-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | DFYWYWZREGWVBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)CN.Cl.Cl |
Computed by PubChem (NCBI)