CAS 1049729-31-8 appears in our catalog under these names: (2-Bromo-6-fluorophenyl)hydrazine hydrochloride, 97%, (2-Bromo-6-fluorophenyl)hydrazine hydrochloride 97%, (2-Bromo-6-fluorophenyl)hydrazine hydrochloride, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
(2-bromo-6-fluorophenyl)hydrazine;hydrochloride (CAS 1049729-31-8) is a chemical compound with the molecular formula C6H7BrClFN2 and a molecular weight of 241.49 g/mol. IUPAC name: (2-bromo-6-fluorophenyl)hydrazine;hydrochloride. InChIKey: UBRQPOGSUUNCBF-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClFN2 |
|---|---|
| Molecular weight | 241.49 g/mol |
| IUPAC name | (2-bromo-6-fluorophenyl)hydrazine;hydrochloride |
| InChIKey | UBRQPOGSUUNCBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)NN)F.Cl |
Computed by PubChem (NCBI)