CAS 2369752-80-5 is the registry number for (3-Bromo-2-fluorophenyl)hydrazine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 50mg.
(3-bromo-2-fluorophenyl)hydrazine;hydrochloride (CAS 2369752-80-5) is a chemical compound with the molecular formula C6H7BrClFN2 and a molecular weight of 241.49 g/mol. IUPAC name: (3-bromo-2-fluorophenyl)hydrazine;hydrochloride. InChIKey: JVQHRNAPEJZLHY-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClFN2 |
|---|---|
| Molecular weight | 241.49 g/mol |
| IUPAC name | (3-bromo-2-fluorophenyl)hydrazine;hydrochloride |
| InChIKey | JVQHRNAPEJZLHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)NN.Cl |
Computed by PubChem (NCBI)