CAS 1049730-17-7 is the registry number for (4-Bromophenyl)(1,2-thiazol-5-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-bromophenyl)-(1,2-thiazol-5-yl)methanol (CAS 1049730-17-7) is a chemical compound with the molecular formula C10H8BrNOS and a molecular weight of 270.15 g/mol. IUPAC name: (4-bromophenyl)-(1,2-thiazol-5-yl)methanol. InChIKey: MENRJDFYANSUQH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNOS |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | (4-bromophenyl)-(1,2-thiazol-5-yl)methanol |
| InChIKey | MENRJDFYANSUQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=NS2)O)Br |
Computed by PubChem (NCBI)