CAS 1049744-68-4 appears in our catalog under these names: (2S,4R)-4-(3-Phenylpropyl)pyrrolidine-2-carboxylic acid hydrochloride, 96%, (2S,4R)-4-(3-Phenylpropyl)pyrrolidine-2-carboxylic acid hydrochloride, 95+%, (2S,4R)-4-(3-Phenylpropyl)pyrrolidine-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,1g.
(2S,4R)-4-(3-phenylpropyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049744-68-4) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: (2S,4R)-4-(3-phenylpropyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: QSJLJVFISOVESU-KZCZEQIWSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | (2S,4R)-4-(3-phenylpropyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | QSJLJVFISOVESU-KZCZEQIWSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CCCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)