Products 2368870-42-0
CAS 2368870-42-0 appears in our catalog under these names: 3-(Azepan-1-ylmethyl)benzoic acid hydrochloride, 97%, 3–(Azepan–1–ylmethyl)benzoic acid hydrochloride, 3-(Azepan-1-ylmethyl)benzoic acid hydrochloride 97%, 3-(Azepan-1-ylmethyl)benzoic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
3-(azepan-1-ylmethyl)benzoic acid;hydrochloride (CAS 2368870-42-0) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: 3-(azepan-1-ylmethyl)benzoic acid;hydrochloride. InChIKey: RLAPOCCXKANNEY-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | 3-(azepan-1-ylmethyl)benzoic acid;hydrochloride |
| InChIKey | RLAPOCCXKANNEY-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)CC2=CC(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)