CAS 1049746-34-0 appears in our catalog under these names: (4-Chloro-3-nitrophenyl)hydrazine hydrochloride, 98%, (4-Chloro-3-nitrophenyl)hydrazine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(4-chloro-3-nitrophenyl)hydrazine;hydrochloride (CAS 1049746-34-0) is a chemical compound with the molecular formula C6H7Cl2N3O2 and a molecular weight of 224.04 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)hydrazine;hydrochloride. InChIKey: PSDGBZPIOJMJRE-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2N3O2 |
|---|---|
| Molecular weight | 224.04 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | PSDGBZPIOJMJRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)[N+](=O)[O-])Cl.Cl |
Computed by PubChem (NCBI)