CAS 1401428-43-0 is the registry number for Methyl (2z)-3-(5-chloro-1h-1,2,4-triazol-3-yl)acrylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl (Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate;hydrochloride (CAS 1401428-43-0) is a chemical compound with the molecular formula C6H7Cl2N3O2 and a molecular weight of 224.04 g/mol. IUPAC name: methyl (Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate;hydrochloride. InChIKey: BHOOQIYULTVNHY-OLGQORCHSA-N.
| Molecular formula | C6H7Cl2N3O2 |
|---|---|
| Molecular weight | 224.04 g/mol |
| IUPAC name | methyl (Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoate;hydrochloride |
| InChIKey | BHOOQIYULTVNHY-OLGQORCHSA-N |
| SMILES | COC(=O)/C=C\C1=NNC(=N1)Cl.Cl |
Computed by PubChem (NCBI)