CAS 1049752-75-1 appears in our catalog under these names: 5,6-Diaminonaphthalene-1-sulfonamide hydrochloride, 97%, 1,2-Diamino-naphthalene-5-sulfonamide, Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
5,6-diaminonaphthalene-1-sulfonamide;hydrochloride (CAS 1049752-75-1) is a chemical compound with the molecular formula C10H12ClN3O2S and a molecular weight of 273.74 g/mol. IUPAC name: 5,6-diaminonaphthalene-1-sulfonamide;hydrochloride. InChIKey: ZIPFCXOSUIWJFT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O2S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 5,6-diaminonaphthalene-1-sulfonamide;hydrochloride |
| InChIKey | ZIPFCXOSUIWJFT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N)N)C(=C1)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)