CAS 1803604-03-6 appears in our catalog under these names: 3-(5-(Thiophen-2-yl)-1,3,4-oxadiazol-2-yl)morpholine hydrochloride, 95%, 3-(5-(Thiophen-2-yl)-1,3,4-oxadiazol-2-yl)morpholine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)morpholine;hydrochloride (CAS 1803604-03-6) is a chemical compound with the molecular formula C10H12ClN3O2S and a molecular weight of 273.74 g/mol. IUPAC name: 3-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)morpholine;hydrochloride. InChIKey: LFCCUPCTHNIBCM-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O2S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 3-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)morpholine;hydrochloride |
| InChIKey | LFCCUPCTHNIBCM-UHFFFAOYSA-N |
| SMILES | C1COCC(N1)C2=NN=C(O2)C3=CC=CS3.Cl |
Computed by PubChem (NCBI)