CAS 1049755-14-7 appears in our catalog under these names: (2S,4R)-4-Allylpyrrolidine-2-carboxylic acid hydrochloride, 95%, H-trans-4-Allyl-Pro-OH HCl 95%, (2S,4R)-4-Allylpyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg.
(2S,4R)-4-prop-2-enylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049755-14-7) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (2S,4R)-4-prop-2-enylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: QOKUYUBQOIDWLE-HHQFNNIRSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (2S,4R)-4-prop-2-enylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | QOKUYUBQOIDWLE-HHQFNNIRSA-N |
| SMILES | C=CC[C@@H]1C[C@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)