CAS 1049764-17-1 appears in our catalog under these names: N-(3,4-Dichlorophenyl)-2-(methylamino)acetamide hydrochloride, 95%, N-(3,4-Dichlorophenyl)-2-(methylamino)acetamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
N-(3,4-dichlorophenyl)-2-(methylamino)acetamide;hydrochloride (CAS 1049764-17-1) is a chemical compound with the molecular formula C9H11Cl3N2O and a molecular weight of 269.6 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-2-(methylamino)acetamide;hydrochloride. InChIKey: NJBFMQYWLBEXST-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl3N2O |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | NJBFMQYWLBEXST-UHFFFAOYSA-N |
| SMILES | CNCC(=O)NC1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)