CAS 94319-86-5 appears in our catalog under these names: N-(2-Aminoethyl)-3,4-dichlorobenzamide hydrochloride, 95%, N-(2-Aminoethyl)-3,4-dichlorobenzamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-(2-aminoethyl)-3,4-dichlorobenzamide;hydrochloride (CAS 94319-86-5) is a chemical compound with the molecular formula C9H11Cl3N2O and a molecular weight of 269.6 g/mol. IUPAC name: N-(2-aminoethyl)-3,4-dichlorobenzamide;hydrochloride. InChIKey: OMEOVGDODNQWCW-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl3N2O |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | N-(2-aminoethyl)-3,4-dichlorobenzamide;hydrochloride |
| InChIKey | OMEOVGDODNQWCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NCCN)Cl)Cl.Cl |
Computed by PubChem (NCBI)