CAS 1049769-70-1 is the registry number for 7-Chloro-2-((propylamino)methyl)-3,4-dihydroquinazolin-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-chloro-2-(propylaminomethyl)-3H-quinazolin-4-one;hydrochloride (CAS 1049769-70-1) is a chemical compound with the molecular formula C12H15Cl2N3O and a molecular weight of 288.17 g/mol. IUPAC name: 7-chloro-2-(propylaminomethyl)-3H-quinazolin-4-one;hydrochloride. InChIKey: XVVXXXVKMKYUGF-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | 7-chloro-2-(propylaminomethyl)-3H-quinazolin-4-one;hydrochloride |
| InChIKey | XVVXXXVKMKYUGF-UHFFFAOYSA-N |
| SMILES | CCCNCC1=NC2=C(C=CC(=C2)Cl)C(=O)N1.Cl |
Computed by PubChem (NCBI)