CAS 1093390-68-1 is the registry number for {(5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl)methyl}(propan-2-yl)amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine;hydrochloride (CAS 1093390-68-1) is a chemical compound with the molecular formula C12H15Cl2N3O and a molecular weight of 288.17 g/mol. IUPAC name: N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine;hydrochloride. InChIKey: ZABMFVWNKWBGOY-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine;hydrochloride |
| InChIKey | ZABMFVWNKWBGOY-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=NN=C(O1)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)