CAS 1049790-37-5 is the registry number for 4-(Chloromethyl)-2-(4-isopropylphenyl)-1,3-thiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(chloromethyl)-2-(4-propan-2-ylphenyl)-1,3-thiazole;hydrochloride (CAS 1049790-37-5) is a chemical compound with the molecular formula C13H15Cl2NS and a molecular weight of 288.2 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-propan-2-ylphenyl)-1,3-thiazole;hydrochloride. InChIKey: UYGNYLBJHALWCV-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NS |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-propan-2-ylphenyl)-1,3-thiazole;hydrochloride |
| InChIKey | UYGNYLBJHALWCV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NC(=CS2)CCl.Cl |
Computed by PubChem (NCBI)