CAS 60612-23-9 appears in our catalog under these names: Ticlopidine EP Impurity I HCl, N-(2-Chlorobenzyl)-2-(2-thienyl)ethylamine Hydrochloride, >95% (HPLC), N-(2-Chlorobenzyl)-2-(thiophen-2-yl)ethanamine Hydrochloride. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 1g, 500mg, 25mg.
N-[(2-chlorophenyl)methyl]-2-thiophen-2-ylethanamine;hydrochloride (CAS 60612-23-9) is a chemical compound with the molecular formula C13H15Cl2NS and a molecular weight of 288.2 g/mol. IUPAC name: N-[(2-chlorophenyl)methyl]-2-thiophen-2-ylethanamine;hydrochloride. InChIKey: QDHAJZRYUIMPDU-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NS |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | N-[(2-chlorophenyl)methyl]-2-thiophen-2-ylethanamine;hydrochloride |
| InChIKey | QDHAJZRYUIMPDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCCC2=CC=CS2)Cl.Cl |
Computed by PubChem (NCBI)