Products 1049791-62-9

CAS 1049791-62-9 is the registry number for 1-[(2-Chlorophenyl)sulfonyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-(2-chlorophenyl)sulfonylpiperazine;hydrochloride (CAS 1049791-62-9) is a chemical compound with the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.20 g/mol. IUPAC name: 1-(2-chlorophenyl)sulfonylpiperazine;hydrochloride. InChIKey: AUVCTUBDAGMLJY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14Cl2N2O2S
Molecular weight297.20 g/mol
IUPAC name1-(2-chlorophenyl)sulfonylpiperazine;hydrochloride
InChIKeyAUVCTUBDAGMLJY-UHFFFAOYSA-N
SMILESC1CN(CCN1)S(=O)(=O)C2=CC=CC=C2Cl.Cl

Computed by PubChem (NCBI)