CAS 1837553-66-8 is the registry number for 1-(3-Chlorobenzenesulfonyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.
1-(3-chlorophenyl)sulfonylpiperazine;hydrochloride (CAS 1837553-66-8) is a chemical compound with the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.20 g/mol. IUPAC name: 1-(3-chlorophenyl)sulfonylpiperazine;hydrochloride. InChIKey: CPTAYOGRIGNYQW-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O2S |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | 1-(3-chlorophenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | CPTAYOGRIGNYQW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)