CAS 1049872-66-3 appears in our catalog under these names: 1-(5-(2-Bromophenyl)thiophen-2-yl)ethan-1-one, 95%, 1-(5-(2-Bromophenyl)thiophen-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-[5-(2-bromophenyl)thiophen-2-yl]ethanone (CAS 1049872-66-3) is a chemical compound with the molecular formula C12H9BrOS and a molecular weight of 281.17 g/mol. IUPAC name: 1-[5-(2-bromophenyl)thiophen-2-yl]ethanone. InChIKey: JRAIRAGKWDGNMB-UHFFFAOYSA-N.
| Molecular formula | C12H9BrOS |
|---|---|
| Molecular weight | 281.17 g/mol |
| IUPAC name | 1-[5-(2-bromophenyl)thiophen-2-yl]ethanone |
| InChIKey | JRAIRAGKWDGNMB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)