CAS 56824-81-8 is the registry number for 1-(5-Bromothiophen-2-yl)-2-phenylethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(5-bromothiophen-2-yl)-2-phenylethanone (CAS 56824-81-8) is a chemical compound with the molecular formula C12H9BrOS and a molecular weight of 281.17 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)-2-phenylethanone. InChIKey: WNNMXAUWNZRTOR-UHFFFAOYSA-N.
| Molecular formula | C12H9BrOS |
|---|---|
| Molecular weight | 281.17 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)-2-phenylethanone |
| InChIKey | WNNMXAUWNZRTOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)