Products 1049973-21-8
CAS 1049973-21-8 is the registry number for N-((2R)-2-Hydroxy-2-(3-(phenylmethoxy)phenyl)ethyl)-N-methylcarbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl N-[(2R)-2-hydroxy-2-(3-phenylmethoxyphenyl)ethyl]-N-methylcarbamate (CAS 1049973-21-8) is a chemical compound with the molecular formula C21H27NO4 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl N-[(2R)-2-hydroxy-2-(3-phenylmethoxyphenyl)ethyl]-N-methylcarbamate. InChIKey: LQTKRYLUIGBUEZ-IBGZPJMESA-N.
| Molecular formula | C21H27NO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl N-[(2R)-2-hydroxy-2-(3-phenylmethoxyphenyl)ethyl]-N-methylcarbamate |
| InChIKey | LQTKRYLUIGBUEZ-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C[C@@H](C1=CC(=CC=C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)