CAS 120303-53-9 is the registry number for N-((-)-Jasmonoyl)-(L)-phenlalanine. Offered by: TRC. Available pack sizes: 5mg.
(2S)-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-phenylpropanoic acid (CAS 120303-53-9) is a chemical compound with the molecular formula C21H27NO4 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-phenylpropanoic acid. InChIKey: BYYWRCJZFSTRMQ-ONYWMEGZSA-N.
| Molecular formula | C21H27NO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-phenylpropanoic acid |
| InChIKey | BYYWRCJZFSTRMQ-ONYWMEGZSA-N |
| SMILES | CC/C=C\C[C@H]1[C@@H](CCC1=O)CC(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)