Products 174607-70-6

CAS 174607-70-6 is the registry number for Salbutamol Impurity 75. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-phenylmethoxybenzoate (CAS 174607-70-6) is a chemical compound with the molecular formula C21H27NO4 and a molecular weight of 357.4 g/mol. IUPAC name: methyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-phenylmethoxybenzoate. InChIKey: XKKHEBAZHSBZQI-UHFFFAOYSA-N.

Identity
Molecular formulaC21H27NO4
Molecular weight357.4 g/mol
IUPAC namemethyl 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-phenylmethoxybenzoate
InChIKeyXKKHEBAZHSBZQI-UHFFFAOYSA-N
SMILESCC(C)(C)NCC(C1=CC(=C(C=C1)OCC2=CC=CC=C2)C(=O)OC)O

Computed by PubChem (NCBI)