CAS 1049978-62-2 appears in our catalog under these names: 5-[(1E)-2-Phenylethenyl]-1,3,4-thiadiazol-2-amine, 95%, 5-Styryl-[1,3,4]thiadiazol-2-ylamine, 95%, (E)-5-Styryl-1,3,4-thiadiazol-2-amine, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
5-[(E)-2-phenylethenyl]-1,3,4-thiadiazol-2-amine (CAS 1049978-62-2) is a chemical compound with the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. IUPAC name: 5-[(E)-2-phenylethenyl]-1,3,4-thiadiazol-2-amine. InChIKey: MFAWSDUTTXHYTR-VOTSOKGWSA-N.
| Molecular formula | C10H9N3S |
|---|---|
| Molecular weight | 203.27 g/mol |
| IUPAC name | 5-[(E)-2-phenylethenyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | MFAWSDUTTXHYTR-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NN=C(S2)N |
Computed by PubChem (NCBI)